About 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene
6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene (PubChem CID 144871928) has the molecular formula C29H42
and a molecular weight of 390.66 g/mol. Its IUPAC name is 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene.
Molecular Properties
| Compound Name | 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene |
| PubChem CID | 144871928 |
| Molecular Formula | C29H42 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.33 |
| IUPAC Name | 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene |
| SMILES | CC.CC.CC.Cc1cc2c(cc1C)CCC=C2.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H14.C11H10.3C2H6/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-9-6-7-10-4-2-3-5-11(10)8-9;3*1-2/h3,5,7-8H,4,6H2,1-2H3;2-8H,1H3;3*1-2H3 |
| InChIKey | LSVPJOVQYADQEA-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene?
The IUPAC name of 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene (CID 144871928) is 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene.
What is the SMILES notation for 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene?
The canonical SMILES for 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene is CC.CC.CC.Cc1cc2c(cc1C)CCC=C2.Cc1ccc2ccccc2c1.
What is the InChIKey of 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene?
The InChIKey is LSVPJOVQYADQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.C11H10.3C2H6/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-9-6-7-10-4-2-3-5-11(10)8-9;3*1-2/h3,5,7-8H,4,6H2,1-2H3;2-8H,1H3;3*1-2H3.
What are the key properties of 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene?
6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene has a molecular weight of 390.66 g/mol, XLogP of 9.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1,2-dihydronaphthalene;ethane;2-methylnaphthalene is sourced from PubChem (CID 144871928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).