C11H16N2 — CID 144871947
2,8-diethyl-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 144871947) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,8-diethyl-2,3-dihydroimidazo[1,2-a]pyridine.
| Compound Name | 2,8-diethyl-2,3-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 144871947 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,8-diethyl-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | CCC1=CC=CN2CC(CC)N=C12 |
| InChI | InChI=1S/C11H16N2/c1-3-9-6-5-7-13-8-10(4-2)12-11(9)13/h5-7,10H,3-4,8H2,1-2H3 |
| InChIKey | VMCQACKFIARJNL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |