About 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol
3-bromo-2-fluoropyridine-4-carbaldehyde;methanol (PubChem CID 144871989) has the molecular formula C7H7BrFNO2
and a molecular weight of 236.04 g/mol. Its IUPAC name is 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol.
Molecular Properties
| Compound Name | 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol |
| PubChem CID | 144871989 |
| Molecular Formula | C7H7BrFNO2 |
| Molecular Weight | 236.04 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol |
| SMILES | CO.O=Cc1ccnc(F)c1Br |
| InChI | InChI=1S/C6H3BrFNO.CH4O/c7-5-4(3-10)1-2-9-6(5)8;1-2/h1-3H;2H,1H3 |
| InChIKey | YRACBPXULUYTEU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.04 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol?
The IUPAC name of 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol (CID 144871989) is 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol.
What is the SMILES notation for 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol?
The canonical SMILES for 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol is CO.O=Cc1ccnc(F)c1Br.
What is the InChIKey of 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol?
The InChIKey is YRACBPXULUYTEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrFNO.CH4O/c7-5-4(3-10)1-2-9-6(5)8;1-2/h1-3H;2H,1H3.
What are the key properties of 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol?
3-bromo-2-fluoropyridine-4-carbaldehyde;methanol has a molecular weight of 236.04 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-fluoropyridine-4-carbaldehyde;methanol is sourced from PubChem (CID 144871989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).