C20H22N6 — CID 144872359
2-[2-(1H-indol-3-yl)ethylamino]-4-[(3-methylcyclobutyl)amino]pyrimidine-5-carbonitrile (PubChem CID 144872359) has the molecular formula C20H22N6 and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)ethylamino]-4-[(3-methylcyclobutyl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-(1H-indol-3-yl)ethylamino]-4-[(3-methylcyclobutyl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 144872359 |
| Molecular Formula | C20H22N6 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)ethylamino]-4-[(3-methylcyclobutyl)amino]pyrimidine-5-carbonitrile |
| SMILES | CC1CC(Nc2nc(NCCc3c[nH]c4ccccc34)ncc2C#N)C1 |
| InChI | InChI=1S/C20H22N6/c1-13-8-16(9-13)25-19-15(10-21)12-24-20(26-19)22-7-6-14-11-23-18-5-3-2-4-17(14)18/h2-5,11-13,16,23H,6-9H2,1H3,(H2,22,24,25,26) |
| InChIKey | QUFNCOPMHVXESR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |