C10H18N4 — CID 144872693
2-N-ethyl-2-N-propylpyridine-2,4,5-triamine (PubChem CID 144872693) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-N-ethyl-2-N-propylpyridine-2,4,5-triamine.
| Compound Name | 2-N-ethyl-2-N-propylpyridine-2,4,5-triamine |
|---|---|
| PubChem CID | 144872693 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-N-ethyl-2-N-propylpyridine-2,4,5-triamine |
| SMILES | CCCN(CC)c1cc(N)c(N)cn1 |
| InChI | InChI=1S/C10H18N4/c1-3-5-14(4-2)10-6-8(11)9(12)7-13-10/h6-7H,3-5,12H2,1-2H3,(H2,11,13) |
| InChIKey | MLAXOCUUHYQPLK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |