About 1-bromo-2-methylfuro[2,3-c]quinoline
1-bromo-2-methylfuro[2,3-c]quinoline (PubChem CID 144872720) has the molecular formula C12H8BrNO
and a molecular weight of 262.11 g/mol. Its IUPAC name is 1-bromo-2-methylfuro[2,3-c]quinoline.
Molecular Properties
| Compound Name | 1-bromo-2-methylfuro[2,3-c]quinoline |
| PubChem CID | 144872720 |
| Molecular Formula | C12H8BrNO |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 1-bromo-2-methylfuro[2,3-c]quinoline |
| SMILES | Cc1oc2cnc3ccccc3c2c1Br |
| InChI | InChI=1S/C12H8BrNO/c1-7-12(13)11-8-4-2-3-5-9(8)14-6-10(11)15-7/h2-6H,1H3 |
| InChIKey | ALDLISLJOMZKIV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-2-methylfuro[2,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methylfuro[2,3-c]quinoline?
The IUPAC name of 1-bromo-2-methylfuro[2,3-c]quinoline (CID 144872720) is 1-bromo-2-methylfuro[2,3-c]quinoline.
What is the SMILES notation for 1-bromo-2-methylfuro[2,3-c]quinoline?
The canonical SMILES for 1-bromo-2-methylfuro[2,3-c]quinoline is Cc1oc2cnc3ccccc3c2c1Br.
What is the InChIKey of 1-bromo-2-methylfuro[2,3-c]quinoline?
The InChIKey is ALDLISLJOMZKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrNO/c1-7-12(13)11-8-4-2-3-5-9(8)14-6-10(11)15-7/h2-6H,1H3.
What are the key properties of 1-bromo-2-methylfuro[2,3-c]quinoline?
1-bromo-2-methylfuro[2,3-c]quinoline has a molecular weight of 262.11 g/mol, XLogP of 4.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methylfuro[2,3-c]quinoline is sourced from PubChem (CID 144872720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).