C19H22F5N5O6S — CID 144872937
2,2,2-trifluoroethyl N-[(2S)-4-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-2-[(1-hydroxyethylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 144872937) has the molecular formula C19H22F5N5O6S and a molecular weight of 543.47 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[(2S)-4-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-2-[(1-hydroxyethylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[(2S)-4-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-2-[(1-hydroxyethylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 144872937 |
| Molecular Formula | C19H22F5N5O6S |
| Molecular Weight | 543.47 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[(2S)-4-[1-(difluoromethyl)-3-methylpyrazol-4-yl]sulfonyl-2-[(1-hydroxyethylamino)methyl]-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | Cc1nn(C(F)F)cc1S(=O)(=O)N1C[C@H](CNC(C)O)Oc2ccc(NC(=O)OCC(F)(F)F)cc21 |
| InChI | InChI=1S/C19H22F5N5O6S/c1-10-16(8-28(27-10)17(20)21)36(32,33)29-7-13(6-25-11(2)30)35-15-4-3-12(5-14(15)29)26-18(31)34-9-19(22,23)24/h3-5,8,11,13,17,25,30H,6-7,9H2,1-2H3,(H,26,31)/t11?,13-/m0/s1 |
| InChIKey | DFHVHJLEGKWCFW-YUZLPWPTSA-N |
| XLogP | 2.58 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|