C10H13N5O — CID 144874122
ethane;2-(oxiran-2-yl)-6-(tetrazol-1-yl)pyridine (PubChem CID 144874122) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is ethane;2-(oxiran-2-yl)-6-(tetrazol-1-yl)pyridine.
| Compound Name | ethane;2-(oxiran-2-yl)-6-(tetrazol-1-yl)pyridine |
|---|---|
| PubChem CID | 144874122 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | ethane;2-(oxiran-2-yl)-6-(tetrazol-1-yl)pyridine |
| SMILES | CC.c1cc(C2CO2)nc(-n2cnnn2)c1 |
| InChI | InChI=1S/C8H7N5O.C2H6/c1-2-6(7-4-14-7)10-8(3-1)13-5-9-11-12-13;1-2/h1-3,5,7H,4H2;1-2H3 |
| InChIKey | XXPPKLUAXMPOIG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|