C28H34B2F2O4 — CID 144874522
2-[1,1-difluoro-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclobutane-3,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 144874522) has the molecular formula C28H34B2F2O4 and a molecular weight of 494.20 g/mol. Its IUPAC name is 2-[1,1-difluoro-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclobutane-3,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1,1-difluoro-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclobutane-3,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144874522 |
| Molecular Formula | C28H34B2F2O4 |
| Molecular Weight | 494.20 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 2-[1,1-difluoro-7'-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[cyclobutane-3,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2(CC(F)(F)C2)c2cc(B4OC(C)(C)C(C)(C)O4)ccc2-3)OC1(C)C |
| InChI | InChI=1S/C28H34B2F2O4/c1-23(2)24(3,4)34-29(33-23)17-9-11-19-20-12-10-18(30-35-25(5,6)26(7,8)36-30)14-22(20)27(21(19)13-17)15-28(31,32)16-27/h9-14H,15-16H2,1-8H3 |
| InChIKey | BHOZLSPKURBWAQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|