About 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one
1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one (PubChem CID 144875681) has the molecular formula C20H22IN3O3
and a molecular weight of 479.32 g/mol. Its IUPAC name is 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one |
| PubChem CID | 144875681 |
| Molecular Formula | C20H22IN3O3 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one |
| SMILES | O=C(c1ncco1)N1CCCC(C2CC(=O)N(c3cccc(I)c3)C2)CC1 |
| InChI | InChI=1S/C20H22IN3O3/c21-16-4-1-5-17(12-16)24-13-15(11-18(24)25)14-3-2-8-23(9-6-14)20(26)19-22-7-10-27-19/h1,4-5,7,10,12,14-15H,2-3,6,8-9,11,13H2 |
| InChIKey | MSUNVJKDQGIQFY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one?
The IUPAC name of 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one (CID 144875681) is 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one.
What is the SMILES notation for 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one?
The canonical SMILES for 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one is O=C(c1ncco1)N1CCCC(C2CC(=O)N(c3cccc(I)c3)C2)CC1.
What is the InChIKey of 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one?
The InChIKey is MSUNVJKDQGIQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22IN3O3/c21-16-4-1-5-17(12-16)24-13-15(11-18(24)25)14-3-2-8-23(9-6-14)20(26)19-22-7-10-27-19/h1,4-5,7,10,12,14-15H,2-3,6,8-9,11,13H2.
What are the key properties of 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one?
1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one has a molecular weight of 479.32 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-iodophenyl)-4-[1-(1,3-oxazole-2-carbonyl)azepan-4-yl]pyrrolidin-2-one is sourced from PubChem (CID 144875681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).