C46H37N5 — CID 144876829
ethane;18-methyl-11-[5-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]pyrimidin-2-yl]-12-azatricyclo[8.8.0.02,7]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene (PubChem CID 144876829) has the molecular formula C46H37N5 and a molecular weight of 659.84 g/mol. Its IUPAC name is ethane;18-methyl-11-[5-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]pyrimidin-2-yl]-12-azatricyclo[8.8.0.02,7]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene.
| Compound Name | ethane;18-methyl-11-[5-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]pyrimidin-2-yl]-12-azatricyclo[8.8.0.02,7]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 144876829 |
| Molecular Formula | C46H37N5 |
| Molecular Weight | 659.84 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | ethane;18-methyl-11-[5-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]pyrimidin-2-yl]-12-azatricyclo[8.8.0.02,7]octadeca-1(10),2,4,6,8,11,13,15,17-nonaene |
| SMILES | CC.Cc1cccccnc(-c2ncc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccccc4)n3)cn2)c2ccc3ccccc3c12 |
| InChI | InChI=1S/C44H31N5.C2H6/c1-30-13-5-4-12-26-45-42(38-25-24-33-16-10-11-19-37(33)41(30)38)44-46-28-36(29-47-44)40-27-39(48-43(49-40)35-17-8-3-9-18-35)34-22-20-32(21-23-34)31-14-6-2-7-15-31;1-2/h2-29H,1H3;1-2H3/b5-4-,12-4-,13-5+,26-12-,30-13+,41-30-,42-38-,45-26+,45-42-; |
| InChIKey | YZDCBJGPASLQOR-DAAJOGEZSA-N |
| XLogP | 11.76 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.84 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |