About 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane
3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane (PubChem CID 144877176) has the molecular formula C20H34N2
and a molecular weight of 302.51 g/mol. Its IUPAC name is 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane |
| PubChem CID | 144877176 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane |
| SMILES | C=C(C)/C=C\C(CCN1CCC2(CCNCC2)CC1)=C(C)C |
| InChI | InChI=1S/C20H34N2/c1-17(2)5-6-19(18(3)4)7-14-22-15-10-20(11-16-22)8-12-21-13-9-20/h5-6,21H,1,7-16H2,2-4H3/b6-5- |
| InChIKey | VEIHHDNRVZEGKC-WAYWQWQTSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane?
The IUPAC name of 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane (CID 144877176) is 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane?
The canonical SMILES for 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane is C=C(C)/C=C\C(CCN1CCC2(CCNCC2)CC1)=C(C)C.
What is the InChIKey of 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane?
The InChIKey is VEIHHDNRVZEGKC-WAYWQWQTSA-N. The full InChI is InChI=1S/C20H34N2/c1-17(2)5-6-19(18(3)4)7-14-22-15-10-20(11-16-22)8-12-21-13-9-20/h5-6,21H,1,7-16H2,2-4H3/b6-5-.
What are the key properties of 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane?
3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane has a molecular weight of 302.51 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4Z)-6-methyl-3-propan-2-ylidenehepta-4,6-dienyl]-3,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 144877176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).