About [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol
[(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol (PubChem CID 144877432) has the molecular formula C15H33N3O4
and a molecular weight of 319.45 g/mol. Its IUPAC name is [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol.
Molecular Properties
| Compound Name | [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol |
| PubChem CID | 144877432 |
| Molecular Formula | C15H33N3O4 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol |
| SMILES | CN1CCN(CC(CO)CO)CC1.CN1CCO[C@@H](CO)C1 |
| InChI | InChI=1S/C9H20N2O2.C6H13NO2/c1-10-2-4-11(5-3-10)6-9(7-12)8-13;1-7-2-3-9-6(4-7)5-8/h9,12-13H,2-8H2,1H3;6,8H,2-5H2,1H3/t;6-/m.1/s1 |
| InChIKey | GVGIWYOVNRPOAZ-FCXZQVPUSA-N |
| XLogP | -1.86 |
| TPSA | 79.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol?
The IUPAC name of [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol (CID 144877432) is [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol.
What is the SMILES notation for [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol?
The canonical SMILES for [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol is CN1CCN(CC(CO)CO)CC1.CN1CCO[C@@H](CO)C1.
What is the InChIKey of [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol?
The InChIKey is GVGIWYOVNRPOAZ-FCXZQVPUSA-N. The full InChI is InChI=1S/C9H20N2O2.C6H13NO2/c1-10-2-4-11(5-3-10)6-9(7-12)8-13;1-7-2-3-9-6(4-7)5-8/h9,12-13H,2-8H2,1H3;6,8H,2-5H2,1H3/t;6-/m.1/s1.
What are the key properties of [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol?
[(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol has a molecular weight of 319.45 g/mol, XLogP of -1.86, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-methylmorpholin-2-yl]methanol;2-[(4-methylpiperazin-1-yl)methyl]propane-1,3-diol is sourced from PubChem (CID 144877432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).