About (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine
(2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine (PubChem CID 144877715) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine |
| PubChem CID | 144877715 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine |
| SMILES | [H]/N=C/C(/C=C/CC(C)C)=C(/C)N |
| InChI | InChI=1S/C10H18N2/c1-8(2)5-4-6-10(7-11)9(3)12/h4,6-8,11H,5,12H2,1-3H3/b6-4+,10-9-,11-7+ |
| InChIKey | DNNOXCHEUUHBML-VJXFAQNQSA-N |
| XLogP | 2.47 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine?
The IUPAC name of (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine (CID 144877715) is (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine?
The canonical SMILES for (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine is [H]/N=C/C(/C=C/CC(C)C)=C(/C)N.
What is the InChIKey of (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine?
The InChIKey is DNNOXCHEUUHBML-VJXFAQNQSA-N. The full InChI is InChI=1S/C10H18N2/c1-8(2)5-4-6-10(7-11)9(3)12/h4,6-8,11H,5,12H2,1-3H3/b6-4+,10-9-,11-7+.
What are the key properties of (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine?
(2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine has a molecular weight of 166.27 g/mol, XLogP of 2.47, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-3-methanimidoyl-7-methylocta-2,4-dien-2-amine is sourced from PubChem (CID 144877715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).