About 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane
1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane (PubChem CID 144877768) has the molecular formula C18H26Br2
and a molecular weight of 402.21 g/mol. Its IUPAC name is 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane.
Molecular Properties
| Compound Name | 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane |
| PubChem CID | 144877768 |
| Molecular Formula | C18H26Br2 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane |
| SMILES | CC.CC.Cc1ccc(Br)cc1.Cc1cccc(Br)c1 |
| InChI | InChI=1S/2C7H7Br.2C2H6/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;2*1-2/h2*2-5H,1H3;2*1-2H3 |
| InChIKey | HBPUERFCMSBTTJ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane?
The IUPAC name of 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane (CID 144877768) is 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane.
What is the SMILES notation for 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane?
The canonical SMILES for 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane is CC.CC.Cc1ccc(Br)cc1.Cc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane?
The InChIKey is HBPUERFCMSBTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7Br.2C2H6/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;2*1-2/h2*2-5H,1H3;2*1-2H3.
What are the key properties of 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane?
1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane has a molecular weight of 402.21 g/mol, XLogP of 7.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methylbenzene;1-bromo-4-methylbenzene;ethane is sourced from PubChem (CID 144877768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).