About (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine
(4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine (PubChem CID 144877980) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine.
Molecular Properties
| Compound Name | (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine |
| PubChem CID | 144877980 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine |
| SMILES | C=C/C=C1/OCN/C1=C/C |
| InChI | InChI=1S/C8H11NO/c1-3-5-8-7(4-2)9-6-10-8/h3-5,9H,1,6H2,2H3/b7-4+,8-5+ |
| InChIKey | JKQXADJNYSJUBF-NSLJXJERSA-N |
| XLogP | 1.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine?
The IUPAC name of (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine (CID 144877980) is (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine.
What is the SMILES notation for (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine?
The canonical SMILES for (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine is C=C/C=C1/OCN/C1=C/C.
What is the InChIKey of (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine?
The InChIKey is JKQXADJNYSJUBF-NSLJXJERSA-N. The full InChI is InChI=1S/C8H11NO/c1-3-5-8-7(4-2)9-6-10-8/h3-5,9H,1,6H2,2H3/b7-4+,8-5+.
What are the key properties of (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine?
(4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine has a molecular weight of 137.18 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4-ethylidene-5-prop-2-enylidene-1,3-oxazolidine is sourced from PubChem (CID 144877980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).