About N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine
N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine (PubChem CID 144878077) has the molecular formula C10H16N4S
and a molecular weight of 224.33 g/mol. Its IUPAC name is N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine |
| PubChem CID | 144878077 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine |
| SMILES | C=CN(CCC(NC)c1cncs1)N=C |
| InChI | InChI=1S/C10H16N4S/c1-4-14(12-3)6-5-9(11-2)10-7-13-8-15-10/h4,7-9,11H,1,3,5-6H2,2H3 |
| InChIKey | ZMQYWVCQRPTDAQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine?
The IUPAC name of N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine (CID 144878077) is N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine.
What is the SMILES notation for N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine?
The canonical SMILES for N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine is C=CN(CCC(NC)c1cncs1)N=C.
What is the InChIKey of N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine?
The InChIKey is ZMQYWVCQRPTDAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4S/c1-4-14(12-3)6-5-9(11-2)10-7-13-8-15-10/h4,7-9,11H,1,3,5-6H2,2H3.
What are the key properties of N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine?
N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine has a molecular weight of 224.33 g/mol, XLogP of 1.85, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-N-methyl-N'-(methylideneamino)-1-(1,3-thiazol-5-yl)propane-1,3-diamine is sourced from PubChem (CID 144878077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).