C13H29N3 — CID 144878402
1,4-dimethylpiperazine;1,3-dimethylpiperidine (PubChem CID 144878402) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;1,3-dimethylpiperidine.
| Compound Name | 1,4-dimethylpiperazine;1,3-dimethylpiperidine |
|---|---|
| PubChem CID | 144878402 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 1,4-dimethylpiperazine;1,3-dimethylpiperidine |
| SMILES | CC1CCCN(C)C1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C7H15N.C6H14N2/c1-7-4-3-5-8(2)6-7;1-7-3-5-8(2)6-4-7/h7H,3-6H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | OXRZCADBXXQLSV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |