C30H34F3N7O3S — CID 144878431
methylaminomethyl (3Z)-N-(methylideneamino)-1-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-3-pyridinyl]piperidine-3-carboximidothioate;2-pyridin-2-ylacetaldehyde (PubChem CID 144878431) has the molecular formula C30H34F3N7O3S and a molecular weight of 629.71 g/mol. Its IUPAC name is methylaminomethyl (3Z)-N-(methylideneamino)-1-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-3-pyridinyl]piperidine-3-carboximidothioate;2-pyridin-2-ylacetaldehyde.
| Compound Name | methylaminomethyl (3Z)-N-(methylideneamino)-1-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-3-pyridinyl]piperidine-3-carboximidothioate;2-pyridin-2-ylacetaldehyde |
|---|---|
| PubChem CID | 144878431 |
| Molecular Formula | C30H34F3N7O3S |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | methylaminomethyl (3Z)-N-(methylideneamino)-1-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]-3-pyridinyl]piperidine-3-carboximidothioate;2-pyridin-2-ylacetaldehyde |
| SMILES | C=N/N=C(\SCNC)C1CCCN(c2ccc(NC(=O)Cc3cccc(OC(F)(F)F)c3)nc2)C1.O=CCc1ccccn1 |
| InChI | InChI=1S/C23H27F3N6O2S.C7H7NO/c1-27-15-35-22(31-28-2)17-6-4-10-32(14-17)18-8-9-20(29-13-18)30-21(33)12-16-5-3-7-19(11-16)34-23(24,25)26;9-6-4-7-3-1-2-5-8-7/h3,5,7-9,11,13,17,27H,2,4,6,10,12,14-15H2,1H3,(H,29,30,33);1-3,5-6H,4H2/b31-22-; |
| InChIKey | LZVIAHXNLNKUGP-MZZNYRAWSA-N |
| XLogP | 5.12 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|