C27H38N2 — CID 144878632
(8S,9R,10S,13R,14R)-3,9,10,13,14-pentamethyl-17-pyridin-3-yl-1,2,3,4,7,11,12,15-octahydrocyclopenta[a]phenanthren-8-amine (PubChem CID 144878632) has the molecular formula C27H38N2 and a molecular weight of 390.62 g/mol. Its IUPAC name is (8S,9R,10S,13R,14R)-3,9,10,13,14-pentamethyl-17-pyridin-3-yl-1,2,3,4,7,11,12,15-octahydrocyclopenta[a]phenanthren-8-amine.
| Compound Name | (8S,9R,10S,13R,14R)-3,9,10,13,14-pentamethyl-17-pyridin-3-yl-1,2,3,4,7,11,12,15-octahydrocyclopenta[a]phenanthren-8-amine |
|---|---|
| PubChem CID | 144878632 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (8S,9R,10S,13R,14R)-3,9,10,13,14-pentamethyl-17-pyridin-3-yl-1,2,3,4,7,11,12,15-octahydrocyclopenta[a]phenanthren-8-amine |
| SMILES | CC1CC[C@@]2(C)C(=CC[C@]3(N)[C@]2(C)CC[C@]2(C)C(c4cccnc4)=CC[C@@]32C)C1 |
| InChI | InChI=1S/C27H38N2/c1-19-8-11-23(2)21(17-19)9-13-27(28)25(4)12-10-22(20-7-6-16-29-18-20)24(25,3)14-15-26(23,27)5/h6-7,9-10,16,18-19H,8,11-15,17,28H2,1-5H3/t19?,23-,24+,25+,26+,27+/m0/s1 |
| InChIKey | KPYWPRBBQOUVOB-YQLONMCZSA-N |
| XLogP | 6.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|