About 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane
3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane (PubChem CID 144880044) has the molecular formula C27H37N2P
and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane.
Molecular Properties
| Compound Name | 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane |
| PubChem CID | 144880044 |
| Molecular Formula | C27H37N2P |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane |
| SMILES | C=Cc1ccc(Cc2c(CCC)n(CC3CCNCC3)c3ccccc23)cc1.CP |
| InChI | InChI=1S/C26H32N2.CH5P/c1-3-7-25-24(18-21-12-10-20(4-2)11-13-21)23-8-5-6-9-26(23)28(25)19-22-14-16-27-17-15-22;1-2/h4-6,8-13,22,27H,2-3,7,14-19H2,1H3;2H2,1H3 |
| InChIKey | NVTGQUCCHHIIII-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane?
The IUPAC name of 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane (CID 144880044) is 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane.
What is the SMILES notation for 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane?
The canonical SMILES for 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane is C=Cc1ccc(Cc2c(CCC)n(CC3CCNCC3)c3ccccc23)cc1.CP.
What is the InChIKey of 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane?
The InChIKey is NVTGQUCCHHIIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2.CH5P/c1-3-7-25-24(18-21-12-10-20(4-2)11-13-21)23-8-5-6-9-26(23)28(25)19-22-14-16-27-17-15-22;1-2/h4-6,8-13,22,27H,2-3,7,14-19H2,1H3;2H2,1H3.
What are the key properties of 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane?
3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane has a molecular weight of 420.58 g/mol, XLogP of 6.32, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethenylphenyl)methyl]-1-(piperidin-4-ylmethyl)-2-propylindole;methylphosphane is sourced from PubChem (CID 144880044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).