About ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole
ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole (PubChem CID 144880286) has the molecular formula C17H22F4N2O2
and a molecular weight of 362.37 g/mol. Its IUPAC name is ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole |
| PubChem CID | 144880286 |
| Molecular Formula | C17H22F4N2O2 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole |
| SMILES | CC.CCOC=O.Cc1cc(C)n(-c2ccc(C(F)(F)F)c(F)c2)n1 |
| InChI | InChI=1S/C12H10F4N2.C3H6O2.C2H6/c1-7-5-8(2)18(17-7)9-3-4-10(11(13)6-9)12(14,15)16;1-2-5-3-4;1-2/h3-6H,1-2H3;3H,2H2,1H3;1-2H3 |
| InChIKey | QNWDRTVEEHKIRF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole?
The IUPAC name of ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole (CID 144880286) is ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole.
What is the SMILES notation for ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole?
The canonical SMILES for ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole is CC.CCOC=O.Cc1cc(C)n(-c2ccc(C(F)(F)F)c(F)c2)n1.
What is the InChIKey of ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole?
The InChIKey is QNWDRTVEEHKIRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F4N2.C3H6O2.C2H6/c1-7-5-8(2)18(17-7)9-3-4-10(11(13)6-9)12(14,15)16;1-2-5-3-4;1-2/h3-6H,1-2H3;3H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole?
ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole has a molecular weight of 362.37 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl formate;1-[3-fluoro-4-(trifluoromethyl)phenyl]-3,5-dimethylpyrazole is sourced from PubChem (CID 144880286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).