C17H16ClF2N3O — CID 144880564
N-[(3-chloro-6-fluoro-1H-indol-5-yl)methyl]pyridine-3-carboxamide;fluoroethane (PubChem CID 144880564) has the molecular formula C17H16ClF2N3O and a molecular weight of 351.78 g/mol. Its IUPAC name is N-[(3-chloro-6-fluoro-1H-indol-5-yl)methyl]pyridine-3-carboxamide;fluoroethane.
| Compound Name | N-[(3-chloro-6-fluoro-1H-indol-5-yl)methyl]pyridine-3-carboxamide;fluoroethane |
|---|---|
| PubChem CID | 144880564 |
| Molecular Formula | C17H16ClF2N3O |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[(3-chloro-6-fluoro-1H-indol-5-yl)methyl]pyridine-3-carboxamide;fluoroethane |
| SMILES | CCF.O=C(NCc1cc2c(Cl)c[nH]c2cc1F)c1cccnc1 |
| InChI | InChI=1S/C15H11ClFN3O.C2H5F/c16-12-8-19-14-5-13(17)10(4-11(12)14)7-20-15(21)9-2-1-3-18-6-9;1-2-3/h1-6,8,19H,7H2,(H,20,21);2H2,1H3 |
| InChIKey | FPJWALLQUTUHQF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |