C7H11NO — CID 144880651
(2E)-2-(methyliminomethyl)penta-2,4-dien-1-ol (PubChem CID 144880651) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (2E)-2-(methyliminomethyl)penta-2,4-dien-1-ol.
| Compound Name | (2E)-2-(methyliminomethyl)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 144880651 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (2E)-2-(methyliminomethyl)penta-2,4-dien-1-ol |
| SMILES | C=C/C=C(\C=N\C)CO |
| InChI | InChI=1S/C7H11NO/c1-3-4-7(6-9)5-8-2/h3-5,9H,1,6H2,2H3/b7-4+,8-5+ |
| InChIKey | DOAGGRXJFUETHN-NSLJXJERSA-N |
| XLogP | 0.79 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|