C22H30N2O3 — CID 144881131
ethane;N-(hydroxymethyl)-5-[[4-(3-methyl-2-oxopentyl)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 144881131) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is ethane;N-(hydroxymethyl)-5-[[4-(3-methyl-2-oxopentyl)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | ethane;N-(hydroxymethyl)-5-[[4-(3-methyl-2-oxopentyl)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144881131 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | ethane;N-(hydroxymethyl)-5-[[4-(3-methyl-2-oxopentyl)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CC.CCC(C)C(=O)Cc1ccc(Cc2cncc(C(=O)NCO)c2)cc1 |
| InChI | InChI=1S/C20H24N2O3.C2H6/c1-3-14(2)19(24)10-16-6-4-15(5-7-16)8-17-9-18(12-21-11-17)20(25)22-13-23;1-2/h4-7,9,11-12,14,23H,3,8,10,13H2,1-2H3,(H,22,25);1-2H3 |
| InChIKey | LASZKIFHPXIIQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|