About acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane
acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane (PubChem CID 144881353) has the molecular formula C13H20ClF2NO
and a molecular weight of 279.76 g/mol. Its IUPAC name is acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane.
Molecular Properties
| Compound Name | acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane |
| PubChem CID | 144881353 |
| Molecular Formula | C13H20ClF2NO |
| Molecular Weight | 279.76 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane |
| SMILES | CC.CC=O.CNCc1cc(F)c(CCl)cc1F |
| InChI | InChI=1S/C9H10ClF2N.C2H4O.C2H6/c1-13-5-7-3-8(11)6(4-10)2-9(7)12;1-2-3;1-2/h2-3,13H,4-5H2,1H3;2H,1H3;1-2H3 |
| InChIKey | DKPXEGXAPGXDGR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane?
The IUPAC name of acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane (CID 144881353) is acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane.
What is the SMILES notation for acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane?
The canonical SMILES for acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane is CC.CC=O.CNCc1cc(F)c(CCl)cc1F.
What is the InChIKey of acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane?
The InChIKey is DKPXEGXAPGXDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF2N.C2H4O.C2H6/c1-13-5-7-3-8(11)6(4-10)2-9(7)12;1-2-3;1-2/h2-3,13H,4-5H2,1H3;2H,1H3;1-2H3.
What are the key properties of acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane?
acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane has a molecular weight of 279.76 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1-[4-(chloromethyl)-2,5-difluorophenyl]-N-methylmethanamine;ethane is sourced from PubChem (CID 144881353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).