C28H29N5O4 — CID 144881428
methyl 2-[[(3Z)-4-amino-2-imino-3-methylhexa-3,5-dienoyl]amino]-2-[5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-pyridinyl]acetate (PubChem CID 144881428) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is methyl 2-[[(3Z)-4-amino-2-imino-3-methylhexa-3,5-dienoyl]amino]-2-[5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-pyridinyl]acetate.
| Compound Name | methyl 2-[[(3Z)-4-amino-2-imino-3-methylhexa-3,5-dienoyl]amino]-2-[5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 144881428 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | methyl 2-[[(3Z)-4-amino-2-imino-3-methylhexa-3,5-dienoyl]amino]-2-[5-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-pyridinyl]acetate |
| SMILES | [H]/N=C(C(=O)NC(C(=O)OC)c1cncc(Cc2ccc(Cn3ccccc3=O)cc2)c1)\C(C)=C(/N)C=C |
| InChI | InChI=1S/C28H29N5O4/c1-4-23(29)18(2)25(30)27(35)32-26(28(36)37-3)22-14-21(15-31-16-22)13-19-8-10-20(11-9-19)17-33-12-6-5-7-24(33)34/h4-12,14-16,26,30H,1,13,17,29H2,2-3H3,(H,32,35)/b23-18-,30-25+ |
| InChIKey | UFQALVXKTGWNMT-HYDFTFLBSA-N |
| XLogP | 2.65 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|