C12H24N2 — CID 144881804
ethane;2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole (PubChem CID 144881804) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is ethane;2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole.
| Compound Name | ethane;2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 144881804 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | ethane;2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole |
| SMILES | CC.CN1C=C2CC(C)(C)CCC2N1 |
| InChI | InChI=1S/C10H18N2.C2H6/c1-10(2)5-4-9-8(6-10)7-12(3)11-9;1-2/h7,9,11H,4-6H2,1-3H3;1-2H3 |
| InChIKey | FVEPUVDHMMBHPX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |