C10H18N2 — CID 144881805
2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole (PubChem CID 144881805) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole.
| Compound Name | 2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 144881805 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2,5,5-trimethyl-4,6,7,7a-tetrahydro-1H-indazole |
| SMILES | CN1C=C2CC(C)(C)CCC2N1 |
| InChI | InChI=1S/C10H18N2/c1-10(2)5-4-9-8(6-10)7-12(3)11-9/h7,9,11H,4-6H2,1-3H3 |
| InChIKey | DLPVTPBQVZCHMZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |