C27H28F7NO5S — CID 144882134
(1S)-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol;4-[[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 144882134) has the molecular formula C27H28F7NO5S and a molecular weight of 611.58 g/mol. Its IUPAC name is (1S)-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol;4-[[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | (1S)-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol;4-[[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 144882134 |
| Molecular Formula | C27H28F7NO5S |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | (1S)-3-(4-fluorophenyl)sulfonylcyclopentan-1-ol;4-[[1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-yl]oxymethyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1ccc(C(OCc2c(C)noc2C)(C(F)(F)F)C(F)(F)F)cc1.O=S(=O)(c1ccc(F)cc1)C1CC[C@H](O)C1 |
| InChI | InChI=1S/C16H15F6NO2.C11H13FO3S/c1-9-4-6-12(7-5-9)14(15(17,18)19,16(20,21)22)24-8-13-10(2)23-25-11(13)3;12-8-1-4-10(5-2-8)16(14,15)11-6-3-9(13)7-11/h4-7H,8H2,1-3H3;1-2,4-5,9,11,13H,3,6-7H2/t;9-,11?/m.0/s1 |
| InChIKey | VGIRYLKONNEHKQ-LLLSWLOKSA-N |
| XLogP | 6.65 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |