C10H8F7NO — CID 144882273
1,1,1,3,3,3-hexafluoro-2-(4-fluorophenoxy)-N-methylpropan-2-amine (PubChem CID 144882273) has the molecular formula C10H8F7NO and a molecular weight of 291.17 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(4-fluorophenoxy)-N-methylpropan-2-amine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(4-fluorophenoxy)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 144882273 |
| Molecular Formula | C10H8F7NO |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(4-fluorophenoxy)-N-methylpropan-2-amine |
| SMILES | CNC(Oc1ccc(F)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F7NO/c1-18-8(9(12,13)14,10(15,16)17)19-7-4-2-6(11)3-5-7/h2-5,18H,1H3 |
| InChIKey | MGHDGSKJKYOLAU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|