About CID 144882839
CID 144882839 (PubChem CID 144882839) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol.
Molecular Properties
| Compound Name | CID 144882839 |
| PubChem CID | 144882839 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | — |
| SMILES | [CH]=CC(=O)/C(C)=C(\C[CH2])N(C)C(=O)C1(CC)CCCCC1 |
| InChI | InChI=1S/C18H27NO2/c1-6-15(14(4)16(20)7-2)19(5)17(21)18(8-3)12-10-9-11-13-18/h2,7H,1,6,8-13H2,3-5H3/b7-2?,15-14+ |
| InChIKey | QHUYMEWKOIZBGA-ZJAPBFESSA-N |
| XLogP | 3.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 144882839 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144882839?
The IUPAC name of CID 144882839 (CID 144882839) is not available.
What is the SMILES notation for CID 144882839?
The canonical SMILES for CID 144882839 is [CH]=CC(=O)/C(C)=C(\C[CH2])N(C)C(=O)C1(CC)CCCCC1.
What is the InChIKey of CID 144882839?
The InChIKey is QHUYMEWKOIZBGA-ZJAPBFESSA-N. The full InChI is InChI=1S/C18H27NO2/c1-6-15(14(4)16(20)7-2)19(5)17(21)18(8-3)12-10-9-11-13-18/h2,7H,1,6,8-13H2,3-5H3/b7-2?,15-14+.
What are the key properties of CID 144882839?
CID 144882839 has a molecular weight of 289.42 g/mol, XLogP of 3.86, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144882839 is sourced from PubChem (CID 144882839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).