C26H40N2O3 — CID 144882868
8-[(2S,6E,8E)-3,6-dimethyl-9-(methylamino)deca-6,8-dien-2-yl]-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one (PubChem CID 144882868) has the molecular formula C26H40N2O3 and a molecular weight of 428.62 g/mol. Its IUPAC name is 8-[(2S,6E,8E)-3,6-dimethyl-9-(methylamino)deca-6,8-dien-2-yl]-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one.
| Compound Name | 8-[(2S,6E,8E)-3,6-dimethyl-9-(methylamino)deca-6,8-dien-2-yl]-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 144882868 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 8-[(2S,6E,8E)-3,6-dimethyl-9-(methylamino)deca-6,8-dien-2-yl]-2-(5-oxo-2H-furan-3-yl)-2-azaspiro[4.5]decan-1-one |
| SMILES | CN/C(C)=C/C=C(\C)CCC(C)[C@H](C)C1CCC2(CC1)CCN(C1=CC(=O)OC1)C2=O |
| InChI | InChI=1S/C26H40N2O3/c1-18(7-9-20(3)27-5)6-8-19(2)21(4)22-10-12-26(13-11-22)14-15-28(25(26)30)23-16-24(29)31-17-23/h7,9,16,19,21-22,27H,6,8,10-15,17H2,1-5H3/b18-7+,20-9+/t19?,21-,22?,26?/m0/s1 |
| InChIKey | MYSJDSCTIFONNA-LMUWGHFSSA-N |
| XLogP | 4.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|