About (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane
(3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane (PubChem CID 144883445) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane.
Molecular Properties
| Compound Name | (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane |
| PubChem CID | 144883445 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane |
| SMILES | C[C@H]1CCC(C2=CCCC=C2)SN1C |
| InChI | InChI=1S/C12H19NS/c1-10-8-9-12(14-13(10)2)11-6-4-3-5-7-11/h4,6-7,10,12H,3,5,8-9H2,1-2H3/t10-,12?/m0/s1 |
| InChIKey | NZYHUFCUCMFCAM-NUHJPDEHSA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane?
The IUPAC name of (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane (CID 144883445) is (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane.
What is the SMILES notation for (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane?
The canonical SMILES for (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane is C[C@H]1CCC(C2=CCCC=C2)SN1C.
What is the InChIKey of (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane?
The InChIKey is NZYHUFCUCMFCAM-NUHJPDEHSA-N. The full InChI is InChI=1S/C12H19NS/c1-10-8-9-12(14-13(10)2)11-6-4-3-5-7-11/h4,6-7,10,12H,3,5,8-9H2,1-2H3/t10-,12?/m0/s1.
What are the key properties of (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane?
(3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane has a molecular weight of 209.36 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6-cyclohexa-1,5-dien-1-yl-2,3-dimethylthiazinane is sourced from PubChem (CID 144883445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).