C21H29F2N5O2S — CID 144883514
(7R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-7-ethylthiazepane 1,1-dioxide (PubChem CID 144883514) has the molecular formula C21H29F2N5O2S and a molecular weight of 453.56 g/mol. Its IUPAC name is (7R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-7-ethylthiazepane 1,1-dioxide.
| Compound Name | (7R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-7-ethylthiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 144883514 |
| Molecular Formula | C21H29F2N5O2S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (7R)-2-[[2,5-difluoro-4-[4-(1,2,4-triazol-4-yl)piperidin-1-yl]phenyl]methyl]-7-ethylthiazepane 1,1-dioxide |
| SMILES | CC[C@@H]1CCCCN(Cc2cc(F)c(N3CCC(n4cnnc4)CC3)cc2F)S1(=O)=O |
| InChI | InChI=1S/C21H29F2N5O2S/c1-2-18-5-3-4-8-28(31(18,29)30)13-16-11-20(23)21(12-19(16)22)26-9-6-17(7-10-26)27-14-24-25-15-27/h11-12,14-15,17-18H,2-10,13H2,1H3/t18-/m1/s1 |
| InChIKey | OAQBOTGPYPJGHJ-GOSISDBHSA-N |
| XLogP | 3.49 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|