About 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane
7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane (PubChem CID 144883701) has the molecular formula C22H25N3O3
and a molecular weight of 379.46 g/mol. Its IUPAC name is 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane.
Molecular Properties
| Compound Name | 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane |
| PubChem CID | 144883701 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane |
| SMILES | CC.COc1cc2c(cc1C1=C(C)N=C1C)OCC(=O)N2Cc1ccncc1 |
| InChI | InChI=1S/C20H19N3O3.C2H6/c1-12-20(13(2)22-12)15-8-18-16(9-17(15)25-3)23(19(24)11-26-18)10-14-4-6-21-7-5-14;1-2/h4-9H,10-11H2,1-3H3;1-2H3 |
| InChIKey | ZIGUFSZCMUIUJH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane?
The IUPAC name of 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane (CID 144883701) is 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane.
What is the SMILES notation for 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane?
The canonical SMILES for 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane is CC.COc1cc2c(cc1C1=C(C)N=C1C)OCC(=O)N2Cc1ccncc1.
What is the InChIKey of 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane?
The InChIKey is ZIGUFSZCMUIUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3.C2H6/c1-12-20(13(2)22-12)15-8-18-16(9-17(15)25-3)23(19(24)11-26-18)10-14-4-6-21-7-5-14;1-2/h4-9H,10-11H2,1-3H3;1-2H3.
What are the key properties of 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane?
7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane has a molecular weight of 379.46 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,4-dimethylazet-3-yl)-6-methoxy-4-(pyridin-4-ylmethyl)-1,4-benzoxazin-3-one;ethane is sourced from PubChem (CID 144883701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).