C15H22O5 — CID 14488475
(5S,5aS,7R,8aR,9S)-5,9-dihydroxy-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydro-1H-azuleno[5,6-c]furan-3-one (PubChem CID 14488475) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (5S,5aS,7R,8aR,9S)-5,9-dihydroxy-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydro-1H-azuleno[5,6-c]furan-3-one.
| Compound Name | (5S,5aS,7R,8aR,9S)-5,9-dihydroxy-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydro-1H-azuleno[5,6-c]furan-3-one |
|---|---|
| PubChem CID | 14488475 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (5S,5aS,7R,8aR,9S)-5,9-dihydroxy-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydro-1H-azuleno[5,6-c]furan-3-one |
| SMILES | C[C@@]1(CO)C[C@H]2[C@H](O)C3=C(C[C@](C)(O)[C@H]2C1)C(=O)OC3 |
| InChI | InChI=1S/C15H22O5/c1-14(7-16)3-9-11(5-14)15(2,19)4-8-10(12(9)17)6-20-13(8)18/h9,11-12,16-17,19H,3-7H2,1-2H3/t9-,11+,12+,14-,15+/m1/s1 |
| InChIKey | DBKIEMOKQWYZOA-ONAWRNRTSA-N |
| XLogP | 0.38 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |