C15H22O4 — CID 14488477
(5S,5aS,7R,8aR,9S)-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-5,9-diol (PubChem CID 14488477) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (5S,5aS,7R,8aR,9S)-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-5,9-diol.
| Compound Name | (5S,5aS,7R,8aR,9S)-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-5,9-diol |
|---|---|
| PubChem CID | 14488477 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (5S,5aS,7R,8aR,9S)-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydroazuleno[5,6-c]furan-5,9-diol |
| SMILES | C[C@@]1(CO)C[C@H]2[C@H](O)c3cocc3C[C@](C)(O)[C@H]2C1 |
| InChI | InChI=1S/C15H22O4/c1-14(8-16)4-10-12(5-14)15(2,18)3-9-6-19-7-11(9)13(10)17/h6-7,10,12-13,16-18H,3-5,8H2,1-2H3/t10-,12+,13+,14-,15+/m1/s1 |
| InChIKey | LPXNISGTRUGQGS-NZNQWUEYSA-N |
| XLogP | 1.64 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |