C26H25N7O — CID 144884987
4-[5-cyclobutyl-4-(1-oxidopiperazin-1-ium-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-9H-pyrido[2,3-b]indole (PubChem CID 144884987) has the molecular formula C26H25N7O and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-[5-cyclobutyl-4-(1-oxidopiperazin-1-ium-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-9H-pyrido[2,3-b]indole.
| Compound Name | 4-[5-cyclobutyl-4-(1-oxidopiperazin-1-ium-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 144884987 |
| Molecular Formula | C26H25N7O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[5-cyclobutyl-4-(1-oxidopiperazin-1-ium-1-yl)pyrido[3,4-d]pyrimidin-2-yl]-9H-pyrido[2,3-b]indole |
| SMILES | [O-][N+]1(c2nc(-c3ccnc4[nH]c5ccccc5c34)nc3cncc(C4CCC4)c23)CCNCC1 |
| InChI | InChI=1S/C26H25N7O/c34-33(12-10-27-11-13-33)26-23-19(16-4-3-5-16)14-28-15-21(23)31-24(32-26)18-8-9-29-25-22(18)17-6-1-2-7-20(17)30-25/h1-2,6-9,14-16,27H,3-5,10-13H2,(H,29,30) |
| InChIKey | JGAUEBGPZQLXFF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|