C15H20O4 — CID 14488519
14-hydroxy-1,9-dimethyl-4-methylidene-6,13-dioxatricyclo[8.4.0.03,7]tetradec-11-en-5-one (PubChem CID 14488519) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 14-hydroxy-1,9-dimethyl-4-methylidene-6,13-dioxatricyclo[8.4.0.03,7]tetradec-11-en-5-one.
| Compound Name | 14-hydroxy-1,9-dimethyl-4-methylidene-6,13-dioxatricyclo[8.4.0.03,7]tetradec-11-en-5-one |
|---|---|
| PubChem CID | 14488519 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 14-hydroxy-1,9-dimethyl-4-methylidene-6,13-dioxatricyclo[8.4.0.03,7]tetradec-11-en-5-one |
| SMILES | C=C1C(=O)OC2CC(C)C3C=COC(O)C3(C)CC12 |
| InChI | InChI=1S/C15H20O4/c1-8-6-12-10(9(2)13(16)19-12)7-15(3)11(8)4-5-18-14(15)17/h4-5,8,10-12,14,17H,2,6-7H2,1,3H3 |
| InChIKey | MJFZQEIPHOGQFM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|