C20H24N3O2P — CID 144885373
2-(4-methoxyphenyl)-7-[(3S)-3-methylpiperazin-1-yl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one (PubChem CID 144885373) has the molecular formula C20H24N3O2P and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-7-[(3S)-3-methylpiperazin-1-yl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one.
| Compound Name | 2-(4-methoxyphenyl)-7-[(3S)-3-methylpiperazin-1-yl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
|---|---|
| PubChem CID | 144885373 |
| Molecular Formula | C20H24N3O2P |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-7-[(3S)-3-methylpiperazin-1-yl]-1,9a-dihydropyrido[1,2-a][1,3]azaphosphinin-4-one |
| SMILES | COc1ccc(C2=CC(=O)N3C=C(N4CCN[C@@H](C)C4)C=CC3P2)cc1 |
| InChI | InChI=1S/C20H24N3O2P/c1-14-12-22(10-9-21-14)16-5-8-20-23(13-16)19(24)11-18(26-20)15-3-6-17(25-2)7-4-15/h3-8,11,13-14,20-21,26H,9-10,12H2,1-2H3/t14-,20?/m0/s1 |
| InChIKey | LVFGFZHBXZSYBL-PVCZSOGJSA-N |
| XLogP | 2.59 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|