C15H19F2NO — CID 144885707
(3,3-difluoropyrrolidin-1-yl)-[4-(2-methylprop-2-enyl)cyclohexa-1,5-dien-1-yl]methanone (PubChem CID 144885707) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is (3,3-difluoropyrrolidin-1-yl)-[4-(2-methylprop-2-enyl)cyclohexa-1,5-dien-1-yl]methanone.
| Compound Name | (3,3-difluoropyrrolidin-1-yl)-[4-(2-methylprop-2-enyl)cyclohexa-1,5-dien-1-yl]methanone |
|---|---|
| PubChem CID | 144885707 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (3,3-difluoropyrrolidin-1-yl)-[4-(2-methylprop-2-enyl)cyclohexa-1,5-dien-1-yl]methanone |
| SMILES | C=C(C)CC1C=CC(C(=O)N2CCC(F)(F)C2)=CC1 |
| InChI | InChI=1S/C15H19F2NO/c1-11(2)9-12-3-5-13(6-4-12)14(19)18-8-7-15(16,17)10-18/h3,5-6,12H,1,4,7-10H2,2H3 |
| InChIKey | OZOJHYSPGPICFU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|