C5H9IN2O3S — CID 144886412
2-[[2-(iodosulfanylamino)acetyl]amino]propanoic acid (PubChem CID 144886412) has the molecular formula C5H9IN2O3S and a molecular weight of 304.11 g/mol. Its IUPAC name is 2-[[2-(iodosulfanylamino)acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-(iodosulfanylamino)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 144886412 |
| Molecular Formula | C5H9IN2O3S |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | 2-[[2-(iodosulfanylamino)acetyl]amino]propanoic acid |
| SMILES | CC(NC(=O)CNSI)C(=O)O |
| InChI | InChI=1S/C5H9IN2O3S/c1-3(5(10)11)8-4(9)2-7-12-6/h3,7H,2H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | SCABUVYIZGDTTC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|