C31H45N5O6 — CID 144886413
N-butoxyacetamide;3-methoxy-2-[[2-(3-phenylpropanoylamino)acetyl]amino]-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propanamide (PubChem CID 144886413) has the molecular formula C31H45N5O6 and a molecular weight of 583.73 g/mol. Its IUPAC name is N-butoxyacetamide;3-methoxy-2-[[2-(3-phenylpropanoylamino)acetyl]amino]-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propanamide.
| Compound Name | N-butoxyacetamide;3-methoxy-2-[[2-(3-phenylpropanoylamino)acetyl]amino]-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propanamide |
|---|---|
| PubChem CID | 144886413 |
| Molecular Formula | C31H45N5O6 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | N-butoxyacetamide;3-methoxy-2-[[2-(3-phenylpropanoylamino)acetyl]amino]-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)propanamide |
| SMILES | CCCCONC(C)=O.COCC(NC(=O)CNC(=O)CCc1ccccc1)C(=O)NCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C25H32N4O4.C6H13NO2/c1-33-17-21(25(32)28-15-20-10-5-9-19-11-6-14-26-24(19)20)29-23(31)16-27-22(30)13-12-18-7-3-2-4-8-18;1-3-4-5-9-7-6(2)8/h2-5,7-10,21,26H,6,11-17H2,1H3,(H,27,30)(H,28,32)(H,29,31);3-5H2,1-2H3,(H,7,8) |
| InChIKey | IGPVNMYDEWHWQE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 146.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|