C23H22F2N6O3 — CID 144886548
3-[1-[(2-fluorophenyl)methyl]-3-(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)pyrazol-5-yl]-1,2-oxazole;formic acid (PubChem CID 144886548) has the molecular formula C23H22F2N6O3 and a molecular weight of 468.46 g/mol. Its IUPAC name is 3-[1-[(2-fluorophenyl)methyl]-3-(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)pyrazol-5-yl]-1,2-oxazole;formic acid.
| Compound Name | 3-[1-[(2-fluorophenyl)methyl]-3-(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)pyrazol-5-yl]-1,2-oxazole;formic acid |
|---|---|
| PubChem CID | 144886548 |
| Molecular Formula | C23H22F2N6O3 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[1-[(2-fluorophenyl)methyl]-3-(5-fluoro-4-piperidin-1-ylpyrimidin-2-yl)pyrazol-5-yl]-1,2-oxazole;formic acid |
| SMILES | Fc1ccccc1Cn1nc(-c2ncc(F)c(N3CCCCC3)n2)cc1-c1ccon1.O=CO |
| InChI | InChI=1S/C22H20F2N6O.CH2O2/c23-16-7-3-2-6-15(16)14-30-20(18-8-11-31-28-18)12-19(27-30)21-25-13-17(24)22(26-21)29-9-4-1-5-10-29;2-1-3/h2-3,6-8,11-13H,1,4-5,9-10,14H2;1H,(H,2,3) |
| InChIKey | MVHCPWHWNJVLIC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|