C8H14N2O2 — CID 144886678
(1Z,3Z)-5-(2-aminoethylamino)hexa-1,3,5-triene-1,2-diol (PubChem CID 144886678) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (1Z,3Z)-5-(2-aminoethylamino)hexa-1,3,5-triene-1,2-diol.
| Compound Name | (1Z,3Z)-5-(2-aminoethylamino)hexa-1,3,5-triene-1,2-diol |
|---|---|
| PubChem CID | 144886678 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (1Z,3Z)-5-(2-aminoethylamino)hexa-1,3,5-triene-1,2-diol |
| SMILES | C=C(/C=C\C(O)=C\O)NCCN |
| InChI | InChI=1S/C8H14N2O2/c1-7(10-5-4-9)2-3-8(12)6-11/h2-3,6,10-12H,1,4-5,9H2/b3-2-,8-6- |
| InChIKey | QGXYRHMQQKSVMK-RMFUBFLQSA-N |
| XLogP | 0.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|