C41H26N4O2 — CID 144886936
3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-oxa-3-azahexacyclo[11.9.0.02,10.04,9.016,22.019,21]docosa-1(13),2(10),4,6,8,11,16(22),17-octaen-14-one (PubChem CID 144886936) has the molecular formula C41H26N4O2 and a molecular weight of 606.69 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-oxa-3-azahexacyclo[11.9.0.02,10.04,9.016,22.019,21]docosa-1(13),2(10),4,6,8,11,16(22),17-octaen-14-one.
| Compound Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-oxa-3-azahexacyclo[11.9.0.02,10.04,9.016,22.019,21]docosa-1(13),2(10),4,6,8,11,16(22),17-octaen-14-one |
|---|---|
| PubChem CID | 144886936 |
| Molecular Formula | C41H26N4O2 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-15-oxa-3-azahexacyclo[11.9.0.02,10.04,9.016,22.019,21]docosa-1(13),2(10),4,6,8,11,16(22),17-octaen-14-one |
| SMILES | O=c1oc2c(c3c1ccc1c4ccccc4n(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c13)C1CC1C=C2 |
| InChI | InChI=1S/C41H26N4O2/c46-41-31-20-19-30-29-16-7-8-17-33(29)45(37(30)36(31)35-32-23-26(32)18-21-34(35)47-41)28-15-9-14-27(22-28)40-43-38(24-10-3-1-4-11-24)42-39(44-40)25-12-5-2-6-13-25/h1-22,26,32H,23H2 |
| InChIKey | HWGVGKGACCYBDA-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |