C18H27NO2S — CID 14488746
(2R,4aR,10bR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol (PubChem CID 14488746) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is (2R,4aR,10bR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol.
| Compound Name | (2R,4aR,10bR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol |
|---|---|
| PubChem CID | 14488746 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2R,4aR,10bR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol |
| SMILES | CCCN1C[C@H](CSC)C[C@@H]2c3ccc(O)c(O)c3CC[C@H]21 |
| InChI | InChI=1S/C18H27NO2S/c1-3-8-19-10-12(11-22-2)9-15-13-5-7-17(20)18(21)14(13)4-6-16(15)19/h5,7,12,15-16,20-21H,3-4,6,8-11H2,1-2H3/t12-,15-,16-/m1/s1 |
| InChIKey | ZMAZRCLJSQUSJS-DAXOMENPSA-N |
| XLogP | 3.59 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|