About tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate
tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 144887478) has the molecular formula C13H24N2O3S
and a molecular weight of 288.41 g/mol. Its IUPAC name is tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate |
| PubChem CID | 144887478 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(N)CCS2=O |
| InChI | InChI=1S/C13H24N2O3S/c1-12(2,3)18-11(16)15-7-5-13(6-8-15)10(14)4-9-19(13)17/h10H,4-9,14H2,1-3H3 |
| InChIKey | DOEMCSNOMKURIH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate?
The IUPAC name of tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate (CID 144887478) is tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate.
What is the SMILES notation for tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate?
The canonical SMILES for tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate is CC(C)(C)OC(=O)N1CCC2(CC1)C(N)CCS2=O.
What is the InChIKey of tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate?
The InChIKey is DOEMCSNOMKURIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3S/c1-12(2,3)18-11(16)15-7-5-13(6-8-15)10(14)4-9-19(13)17/h10H,4-9,14H2,1-3H3.
What are the key properties of tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate?
tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate has a molecular weight of 288.41 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-amino-1-oxo-1λ4-thia-8-azaspiro[4.5]decane-8-carboxylate is sourced from PubChem (CID 144887478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).