C22H25NO2S — CID 144887560
ethyl 6-[(3E)-3-[(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)methylidene]pent-4-en-1-ynyl]pyridine-3-carboxylate (PubChem CID 144887560) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is ethyl 6-[(3E)-3-[(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)methylidene]pent-4-en-1-ynyl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(3E)-3-[(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)methylidene]pent-4-en-1-ynyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 144887560 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | ethyl 6-[(3E)-3-[(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)methylidene]pent-4-en-1-ynyl]pyridine-3-carboxylate |
| SMILES | C=C/C(C#Cc1ccc(C(=O)OCC)cn1)=C\C1=C(C)SCCC1(C)C |
| InChI | InChI=1S/C22H25NO2S/c1-6-17(14-20-16(3)26-13-12-22(20,4)5)8-10-19-11-9-18(15-23-19)21(24)25-7-2/h6,9,11,14-15H,1,7,12-13H2,2-5H3/b17-14+ |
| InChIKey | XXJUJXNTFZSYIL-SAPNQHFASA-N |
| XLogP | 5.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|